C23H18FN3O3 — CID 69033759
benzyl 1-amino-5-(3-fluorophenyl)-2-oxo-3H-1,4-benzodiazepine-3-carboxylate (PubChem CID 69033759) has the molecular formula C23H18FN3O3 and a molecular weight of 403.41 g/mol. Its IUPAC name is benzyl 1-amino-5-(3-fluorophenyl)-2-oxo-3H-1,4-benzodiazepine-3-carboxylate.
| Compound Name | benzyl 1-amino-5-(3-fluorophenyl)-2-oxo-3H-1,4-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 69033759 |
| Molecular Formula | C23H18FN3O3 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | benzyl 1-amino-5-(3-fluorophenyl)-2-oxo-3H-1,4-benzodiazepine-3-carboxylate |
| SMILES | NN1C(=O)C(C(=O)OCc2ccccc2)N=C(c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C23H18FN3O3/c24-17-10-6-9-16(13-17)20-18-11-4-5-12-19(18)27(25)22(28)21(26-20)23(29)30-14-15-7-2-1-3-8-15/h1-13,21H,14,25H2 |
| InChIKey | FVGHOOSZMIYFSH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|