benzyl 3-methyl-2H-azirine-2-carboxylate

C11H11NO2 — CID 121219236

IUPACbenzyl 3-methyl-2H-azirine-2-carboxylate
SMILESCC1=NC1C(=O)OCc1ccccc1
InChIInChI=1S/C11H11NO2/c1-8-10(12-8)11(13)14-7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3
InChIKeyLFEMOBGCJUXKEY-UHFFFAOYSA-N
MW189.21 g/mol
LogP1.57
Rot. Bonds3

About benzyl 3-methyl-2H-azirine-2-carboxylate

benzyl 3-methyl-2H-azirine-2-carboxylate (PubChem CID 121219236) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is benzyl 3-methyl-2H-azirine-2-carboxylate.

Molecular Properties

Compound Namebenzyl 3-methyl-2H-azirine-2-carboxylate
PubChem CID121219236
Molecular FormulaC11H11NO2
Molecular Weight189.21 g/mol
Exact Mass189.08
IUPAC Namebenzyl 3-methyl-2H-azirine-2-carboxylate
SMILESCC1=NC1C(=O)OCc1ccccc1
InChIInChI=1S/C11H11NO2/c1-8-10(12-8)11(13)14-7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3
InChIKeyLFEMOBGCJUXKEY-UHFFFAOYSA-N
XLogP1.57
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.21
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 3-methyl-2H-azirine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-methyl-2H-azirine-2-carboxylate?
The IUPAC name of benzyl 3-methyl-2H-azirine-2-carboxylate (CID 121219236) is benzyl 3-methyl-2H-azirine-2-carboxylate.
What is the SMILES notation for benzyl 3-methyl-2H-azirine-2-carboxylate?
The canonical SMILES for benzyl 3-methyl-2H-azirine-2-carboxylate is CC1=NC1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-methyl-2H-azirine-2-carboxylate?
The InChIKey is LFEMOBGCJUXKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-8-10(12-8)11(13)14-7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3.
What are the key properties of benzyl 3-methyl-2H-azirine-2-carboxylate?
benzyl 3-methyl-2H-azirine-2-carboxylate has a molecular weight of 189.21 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-methyl-2H-azirine-2-carboxylate is sourced from PubChem (CID 121219236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).