About benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane
benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane (PubChem CID 157346143) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane.
Analyze benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane?
The IUPAC name of benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane (CID 157346143) is benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane.
What is the SMILES notation for benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane?
The canonical SMILES for benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane is C.CC1=NC(C(=O)OCc2ccccc2)CO1.
What is the InChIKey of benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane?
The InChIKey is GRIIQHZBSZRKJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3.CH4/c1-9-13-11(8-15-9)12(14)16-7-10-5-3-2-4-6-10;/h2-6,11H,7-8H2,1H3;1H4.
What are the key properties of benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane?
benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane has a molecular weight of 235.28 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate;methane is sourced from PubChem (CID 157346143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).