C23H24O6 — CID 143048104
(3R)-3,5-bis(phenylmethoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 143048104) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (3R)-3,5-bis(phenylmethoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | (3R)-3,5-bis(phenylmethoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 143048104 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3R)-3,5-bis(phenylmethoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)OCc2ccccc2)C[C@H](C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C23H24O6/c24-21(25)18-11-19(22(26)28-14-16-7-3-1-4-8-16)13-20(12-18)23(27)29-15-17-9-5-2-6-10-17/h1-10,18-20H,11-15H2,(H,24,25)/t18?,19-,20?/m1/s1 |
| InChIKey | MJYDUAJABXJSRV-IOJLRTSASA-N |
| XLogP | 3.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |