C14H16O3 — CID 11356711
benzyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate (PubChem CID 11356711) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is benzyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate.
| Compound Name | benzyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11356711 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | benzyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CC=C[C@H](O)C1 |
| InChI | InChI=1S/C14H16O3/c15-13-8-4-7-12(9-13)14(16)17-10-11-5-2-1-3-6-11/h1-6,8,12-13,15H,7,9-10H2/t12-,13+/m1/s1 |
| InChIKey | MASOGEATLZULEI-OLZOCXBDSA-N |
| XLogP | 2.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|