C14H14O4 — CID 122382706
(1S,2R)-2-phenylmethoxycarbonylcyclopent-3-ene-1-carboxylic acid (PubChem CID 122382706) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (1S,2R)-2-phenylmethoxycarbonylcyclopent-3-ene-1-carboxylic acid.
| Compound Name | (1S,2R)-2-phenylmethoxycarbonylcyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 122382706 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1S,2R)-2-phenylmethoxycarbonylcyclopent-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H14O4/c15-13(16)11-7-4-8-12(11)14(17)18-9-10-5-2-1-3-6-10/h1-6,8,11-12H,7,9H2,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | UNBBYINJAWSVON-NWDGAFQWSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|