C15H17NO4 — CID 138979495
methyl (1S,5S)-5-(phenylmethoxycarbonylamino)cyclopent-2-ene-1-carboxylate (PubChem CID 138979495) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl (1S,5S)-5-(phenylmethoxycarbonylamino)cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-5-(phenylmethoxycarbonylamino)cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 138979495 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl (1S,5S)-5-(phenylmethoxycarbonylamino)cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C=CC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO4/c1-19-14(17)12-8-5-9-13(12)16-15(18)20-10-11-6-3-2-4-7-11/h2-8,12-13H,9-10H2,1H3,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | AJXINBDRBYMJPP-STQMWFEESA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|