C16H19NO4 — CID 54162931
methyl (1S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate (PubChem CID 54162931) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl (1S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 54162931 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl (1S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CCC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-20-15(18)13-9-5-6-10-14(13)17-16(19)21-11-12-7-3-2-4-8-12/h2-8,13-14H,9-11H2,1H3,(H,17,19)/t13-,14?/m0/s1 |
| InChIKey | OPRIUZGIQNQKGL-LSLKUGRBSA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|