C20H26N2O5 — CID 59691749
benzyl N-[(1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]cyclohex-3-en-1-yl]carbamate (PubChem CID 59691749) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is benzyl N-[(1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]cyclohex-3-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 59691749 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | benzyl N-[(1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)[C@@H]1CC=CC[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O5/c1-20(2,3)27-19(25)22-17(23)15-11-7-8-12-16(15)21-18(24)26-13-14-9-5-4-6-10-14/h4-10,15-16H,11-13H2,1-3H3,(H,21,24)(H,22,23,25)/t15-,16-/m1/s1 |
| InChIKey | ZABSXRMXJZYRBA-HZPDHXFCSA-N |
| XLogP | 3.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|