C17H21NO4 — CID 14320491
[(1S,6R)-6-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl]methyl acetate (PubChem CID 14320491) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(1S,6R)-6-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1S,6R)-6-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 14320491 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(1S,6R)-6-(phenylmethoxycarbonylamino)cyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC=CC[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-13(19)21-12-15-9-5-6-10-16(15)18-17(20)22-11-14-7-3-2-4-8-14/h2-8,15-16H,9-12H2,1H3,(H,18,20)/t15-,16-/m1/s1 |
| InChIKey | URIBQGDLXNTKFZ-HZPDHXFCSA-N |
| XLogP | 2.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|