C20H26O4 — CID 67113186
1-O-benzyl 2-O-butyl 3-methylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 67113186) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-O-benzyl 2-O-butyl 3-methylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-butyl 3-methylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67113186 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-O-benzyl 2-O-butyl 3-methylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1C(C)C=CCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26O4/c1-3-4-13-23-20(22)18-15(2)9-8-12-17(18)19(21)24-14-16-10-6-5-7-11-16/h5-11,15,17-18H,3-4,12-14H2,1-2H3 |
| InChIKey | OAZNBAODFQYXOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|