C27H31NO6 — CID 70340717
1-O,2-O-dibenzyl 3-O-butyl (2S,3S)-5-methylidenepiperidine-1,2,3-tricarboxylate (PubChem CID 70340717) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-O,2-O-dibenzyl 3-O-butyl (2S,3S)-5-methylidenepiperidine-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-dibenzyl 3-O-butyl (2S,3S)-5-methylidenepiperidine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 70340717 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-O,2-O-dibenzyl 3-O-butyl (2S,3S)-5-methylidenepiperidine-1,2,3-tricarboxylate |
| SMILES | C=C1C[C@H](C(=O)OCCCC)[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C27H31NO6/c1-3-4-15-32-25(29)23-16-20(2)17-28(27(31)34-19-22-13-9-6-10-14-22)24(23)26(30)33-18-21-11-7-5-8-12-21/h5-14,23-24H,2-4,15-19H2,1H3/t23-,24-/m0/s1 |
| InChIKey | KUYYXJPJLZSWJL-ZEQRLZLVSA-N |
| XLogP | 4.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|