C27H31NO6 — CID 67006746
(2S,3S)-3-tert-butyl-5-methylidene-1,2-bis(phenylmethoxycarbonyl)piperidine-3-carboxylic acid (PubChem CID 67006746) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is (2S,3S)-3-tert-butyl-5-methylidene-1,2-bis(phenylmethoxycarbonyl)piperidine-3-carboxylic acid.
| Compound Name | (2S,3S)-3-tert-butyl-5-methylidene-1,2-bis(phenylmethoxycarbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67006746 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (2S,3S)-3-tert-butyl-5-methylidene-1,2-bis(phenylmethoxycarbonyl)piperidine-3-carboxylic acid |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@H](C(=O)OCc2ccccc2)[C@@](C(=O)O)(C(C)(C)C)C1 |
| InChI | InChI=1S/C27H31NO6/c1-19-15-27(24(30)31,26(2,3)4)22(23(29)33-17-20-11-7-5-8-12-20)28(16-19)25(32)34-18-21-13-9-6-10-14-21/h5-14,22H,1,15-18H2,2-4H3,(H,30,31)/t22-,27+/m1/s1 |
| InChIKey | QHEBBZQCURNNAA-AMGIVPHBSA-N |
| XLogP | 4.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|