C16H23NO3 — CID 150470163
butyl (2R)-2-phenylmethoxypyrrolidine-1-carboxylate (PubChem CID 150470163) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is butyl (2R)-2-phenylmethoxypyrrolidine-1-carboxylate.
| Compound Name | butyl (2R)-2-phenylmethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150470163 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | butyl (2R)-2-phenylmethoxypyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-2-3-12-19-16(18)17-11-7-10-15(17)20-13-14-8-5-4-6-9-14/h4-6,8-9,15H,2-3,7,10-13H2,1H3/t15-/m1/s1 |
| InChIKey | HRQADRFDLWRKMS-OAHLLOKOSA-N |
| XLogP | 3.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|