C17H23NO4 — CID 156500442
butyl 2-formyl-4-phenylmethoxypyrrolidine-1-carboxylate (PubChem CID 156500442) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is butyl 2-formyl-4-phenylmethoxypyrrolidine-1-carboxylate.
| Compound Name | butyl 2-formyl-4-phenylmethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156500442 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | butyl 2-formyl-4-phenylmethoxypyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC(OCc2ccccc2)CC1C=O |
| InChI | InChI=1S/C17H23NO4/c1-2-3-9-21-17(20)18-11-16(10-15(18)12-19)22-13-14-7-5-4-6-8-14/h4-8,12,15-16H,2-3,9-11,13H2,1H3 |
| InChIKey | DFJQKZOYZMDTBV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|