C18H28N2O2 — CID 95255810
(2S)-2-(4-phenylmethoxypiperidin-1-yl)hexanamide (PubChem CID 95255810) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2S)-2-(4-phenylmethoxypiperidin-1-yl)hexanamide.
| Compound Name | (2S)-2-(4-phenylmethoxypiperidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 95255810 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2S)-2-(4-phenylmethoxypiperidin-1-yl)hexanamide |
| SMILES | CCCC[C@@H](C(N)=O)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-2-3-9-17(18(19)21)20-12-10-16(11-13-20)22-14-15-7-5-4-6-8-15/h4-8,16-17H,2-3,9-14H2,1H3,(H2,19,21)/t17-/m0/s1 |
| InChIKey | JTYHGNFCKPWNNL-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |