C24H32ClNO3 — CID 67831661
2-[4-[[2-(4-methylphenyl)phenyl]methoxy]piperidin-1-yl]pentanoic acid;hydrochloride (PubChem CID 67831661) has the molecular formula C24H32ClNO3 and a molecular weight of 417.98 g/mol. Its IUPAC name is 2-[4-[[2-(4-methylphenyl)phenyl]methoxy]piperidin-1-yl]pentanoic acid;hydrochloride.
| Compound Name | 2-[4-[[2-(4-methylphenyl)phenyl]methoxy]piperidin-1-yl]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67831661 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[4-[[2-(4-methylphenyl)phenyl]methoxy]piperidin-1-yl]pentanoic acid;hydrochloride |
| SMILES | CCCC(C(=O)O)N1CCC(OCc2ccccc2-c2ccc(C)cc2)CC1.Cl |
| InChI | InChI=1S/C24H31NO3.ClH/c1-3-6-23(24(26)27)25-15-13-21(14-16-25)28-17-20-7-4-5-8-22(20)19-11-9-18(2)10-12-19;/h4-5,7-12,21,23H,3,6,13-17H2,1-2H3,(H,26,27);1H |
| InChIKey | IQLXKCVBIQFIPS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |