C24H31Cl2NO3 — CID 70366433
2-[4-[[2-(4-chlorophenyl)phenyl]methoxy]piperidin-1-yl]hexanoic acid;hydrochloride (PubChem CID 70366433) has the molecular formula C24H31Cl2NO3 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-[4-[[2-(4-chlorophenyl)phenyl]methoxy]piperidin-1-yl]hexanoic acid;hydrochloride.
| Compound Name | 2-[4-[[2-(4-chlorophenyl)phenyl]methoxy]piperidin-1-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70366433 |
| Molecular Formula | C24H31Cl2NO3 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[4-[[2-(4-chlorophenyl)phenyl]methoxy]piperidin-1-yl]hexanoic acid;hydrochloride |
| SMILES | CCCCC(C(=O)O)N1CCC(OCc2ccccc2-c2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C24H30ClNO3.ClH/c1-2-3-8-23(24(27)28)26-15-13-21(14-16-26)29-17-19-6-4-5-7-22(19)18-9-11-20(25)12-10-18;/h4-7,9-12,21,23H,2-3,8,13-17H2,1H3,(H,27,28);1H |
| InChIKey | PZVMJFLZZQDLAT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |