C22H26ClNO3 — CID 19874287
2-[4-[[2-(2-chlorophenyl)phenyl]methoxy]piperidin-1-yl]butanoic acid (PubChem CID 19874287) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-[4-[[2-(2-chlorophenyl)phenyl]methoxy]piperidin-1-yl]butanoic acid.
| Compound Name | 2-[4-[[2-(2-chlorophenyl)phenyl]methoxy]piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 19874287 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[4-[[2-(2-chlorophenyl)phenyl]methoxy]piperidin-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1CCC(OCc2ccccc2-c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H26ClNO3/c1-2-21(22(25)26)24-13-11-17(12-14-24)27-15-16-7-3-4-8-18(16)19-9-5-6-10-20(19)23/h3-10,17,21H,2,11-15H2,1H3,(H,25,26) |
| InChIKey | UWEAJCIFKCOQJW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |