C23H25NO4 — CID 176636794
9H-fluoren-9-ylmethyl (2S,4R)-2-formyl-4-propoxypyrrolidine-1-carboxylate (PubChem CID 176636794) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S,4R)-2-formyl-4-propoxypyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S,4R)-2-formyl-4-propoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176636794 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S,4R)-2-formyl-4-propoxypyrrolidine-1-carboxylate |
| SMILES | CCCO[C@@H]1C[C@@H](C=O)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C23H25NO4/c1-2-11-27-17-12-16(14-25)24(13-17)23(26)28-15-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-10,14,16-17,22H,2,11-13,15H2,1H3/t16-,17+/m0/s1 |
| InChIKey | ZNBYAHQXUIXKKF-DLBZAZTESA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|