C15H20N2O4 — CID 175983996
butyl (2R,4S)-2-formyl-4-pyridin-2-yloxypyrrolidine-1-carboxylate (PubChem CID 175983996) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is butyl (2R,4S)-2-formyl-4-pyridin-2-yloxypyrrolidine-1-carboxylate.
| Compound Name | butyl (2R,4S)-2-formyl-4-pyridin-2-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175983996 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | butyl (2R,4S)-2-formyl-4-pyridin-2-yloxypyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@@H](Oc2ccccn2)C[C@@H]1C=O |
| InChI | InChI=1S/C15H20N2O4/c1-2-3-8-20-15(19)17-10-13(9-12(17)11-18)21-14-6-4-5-7-16-14/h4-7,11-13H,2-3,8-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | MOBZEMILVLMRDF-OLZOCXBDSA-N |
| XLogP | 2.04 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|