C21H23NO2 — CID 58682773
9H-fluoren-9-ylmethyl (2S,4R)-2,4-dimethylpyrrolidine-1-carboxylate (PubChem CID 58682773) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S,4R)-2,4-dimethylpyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S,4R)-2,4-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58682773 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S,4R)-2,4-dimethylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@H](C)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C21H23NO2/c1-14-11-15(2)22(12-14)21(23)24-13-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h3-10,14-15,20H,11-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | HJONGROTCDDXEO-CABCVRRESA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |