C26H26N2O2 — CID 154574606
9H-fluoren-9-ylmethyl (2S,5R)-2-methyl-5-phenylpiperazine-1-carboxylate (PubChem CID 154574606) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S,5R)-2-methyl-5-phenylpiperazine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S,5R)-2-methyl-5-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154574606 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S,5R)-2-methyl-5-phenylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN[C@H](c2ccccc2)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26N2O2/c1-18-15-27-25(19-9-3-2-4-10-19)16-28(18)26(29)30-17-24-22-13-7-5-11-20(22)21-12-6-8-14-23(21)24/h2-14,18,24-25,27H,15-17H2,1H3/t18-,25-/m0/s1 |
| InChIKey | HHNLRJKCAOSBBZ-BVZFJXPGSA-N |
| XLogP | 4.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |