C21H32INO4 — CID 177120737
benzyl (2S,3S,4S)-3,4-dibutoxy-2-(iodomethyl)pyrrolidine-1-carboxylate (PubChem CID 177120737) has the molecular formula C21H32INO4 and a molecular weight of 489.39 g/mol. Its IUPAC name is benzyl (2S,3S,4S)-3,4-dibutoxy-2-(iodomethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S)-3,4-dibutoxy-2-(iodomethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177120737 |
| Molecular Formula | C21H32INO4 |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | benzyl (2S,3S,4S)-3,4-dibutoxy-2-(iodomethyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)CN(C(=O)OCc2ccccc2)[C@@H]1CI |
| InChI | InChI=1S/C21H32INO4/c1-3-5-12-25-19-15-23(18(14-22)20(19)26-13-6-4-2)21(24)27-16-17-10-8-7-9-11-17/h7-11,18-20H,3-6,12-16H2,1-2H3/t18-,19+,20+/m1/s1 |
| InChIKey | VDJNQLITARCOAU-AABGKKOBSA-N |
| XLogP | 4.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|