C36H39NO5S — CID 101009575
benzyl (2S,3S,4R,5R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate (PubChem CID 101009575) has the molecular formula C36H39NO5S and a molecular weight of 597.78 g/mol. Its IUPAC name is benzyl (2S,3S,4R,5R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4R,5R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101009575 |
| Molecular Formula | C36H39NO5S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | benzyl (2S,3S,4R,5R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate |
| SMILES | CCS[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H39NO5S/c1-2-43-35-34(41-26-30-19-11-5-12-20-30)33(40-25-29-17-9-4-10-18-29)32(39-24-28-15-7-3-8-16-28)23-37(35)36(38)42-27-31-21-13-6-14-22-31/h3-22,32-35H,2,23-27H2,1H3/t32-,33-,34+,35+/m1/s1 |
| InChIKey | PDGMOOJPMHGSDD-WDKGQIBQSA-N |
| XLogP | 7.47 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |