C36H39NO7 — CID 11721325
benzyl (2R,3R,4R,5S,6R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)azepane-1-carboxylate (PubChem CID 11721325) has the molecular formula C36H39NO7 and a molecular weight of 597.71 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5S,6R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)azepane-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5S,6R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 11721325 |
| Molecular Formula | C36H39NO7 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | benzyl (2R,3R,4R,5S,6R)-5,6-dihydroxy-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)azepane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H](O)[C@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C36H39NO7/c38-32-21-37(36(40)44-25-30-19-11-4-12-20-30)31(26-41-22-27-13-5-1-6-14-27)34(42-23-28-15-7-2-8-16-28)35(33(32)39)43-24-29-17-9-3-10-18-29/h1-20,31-35,38-39H,21-26H2/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | UBMKVXBVTUXPKV-CKQPALCZSA-N |
| XLogP | 5.12 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |