C28H31NO7 — CID 130422396
(2R,3R,5R,6R)-2,3-dihydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-1-carboxylic acid (PubChem CID 130422396) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is (2R,3R,5R,6R)-2,3-dihydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-1-carboxylic acid.
| Compound Name | (2R,3R,5R,6R)-2,3-dihydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 130422396 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2R,3R,5R,6R)-2,3-dihydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1[C@H](O)[C@H](O)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C28H31NO7/c30-24-26(36-18-22-14-8-3-9-15-22)25(35-17-21-12-6-2-7-13-21)23(29(27(24)31)28(32)33)19-34-16-20-10-4-1-5-11-20/h1-15,23-27,30-31H,16-19H2,(H,32,33)/t23-,24-,25-,26?,27-/m1/s1 |
| InChIKey | OUZIKVMVGVZUEO-UDHJXZOWSA-N |
| XLogP | 3.42 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |