C42H45NO5 — CID 135009168
(3S,4S,5S,6R,7S)-1-benzyl-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)azepan-3-ol (PubChem CID 135009168) has the molecular formula C42H45NO5 and a molecular weight of 643.82 g/mol. Its IUPAC name is (3S,4S,5S,6R,7S)-1-benzyl-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)azepan-3-ol.
| Compound Name | (3S,4S,5S,6R,7S)-1-benzyl-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)azepan-3-ol |
|---|---|
| PubChem CID | 135009168 |
| Molecular Formula | C42H45NO5 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | (3S,4S,5S,6R,7S)-1-benzyl-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)azepan-3-ol |
| SMILES | O[C@H]1CN(Cc2ccccc2)[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H45NO5/c44-39-27-43(26-33-16-6-1-7-17-33)38(32-45-28-34-18-8-2-9-19-34)40(46-29-35-20-10-3-11-21-35)42(48-31-37-24-14-5-15-25-37)41(39)47-30-36-22-12-4-13-23-36/h1-25,38-42,44H,26-32H2/t38-,39-,40+,41-,42-/m0/s1 |
| InChIKey | SCYPXPMZQLFNGN-SRWPCTQNSA-N |
| XLogP | 7.20 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |