C37H43NO4 — CID 158056733
(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-propylpiperidine (PubChem CID 158056733) has the molecular formula C37H43NO4 and a molecular weight of 565.75 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-propylpiperidine.
| Compound Name | (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-propylpiperidine |
|---|---|
| PubChem CID | 158056733 |
| Molecular Formula | C37H43NO4 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-propylpiperidine |
| SMILES | CCCN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C37H43NO4/c1-2-23-38-24-35(40-26-31-17-9-4-10-18-31)37(42-28-33-21-13-6-14-22-33)36(41-27-32-19-11-5-12-20-32)34(38)29-39-25-30-15-7-3-8-16-30/h3-22,34-37H,2,23-29H2,1H3/t34-,35-,36+,37+/m0/s1 |
| InChIKey | FKDKRIHYAVQNPZ-DNMDQSTESA-N |
| XLogP | 7.05 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |