C31H41NO4Si — CID 173332615
(3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(trimethylsilylmethyl)piperidin-3-ol (PubChem CID 173332615) has the molecular formula C31H41NO4Si and a molecular weight of 519.76 g/mol. Its IUPAC name is (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(trimethylsilylmethyl)piperidin-3-ol.
| Compound Name | (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(trimethylsilylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 173332615 |
| Molecular Formula | C31H41NO4Si |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(trimethylsilylmethyl)piperidin-3-ol |
| SMILES | C[Si](C)(C)CN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)C1COCc1ccccc1 |
| InChI | InChI=1S/C31H41NO4Si/c1-37(2,3)24-32-19-29(35-21-26-15-9-5-10-16-26)31(36-22-27-17-11-6-12-18-27)30(33)28(32)23-34-20-25-13-7-4-8-14-25/h4-18,28-31,33H,19-24H2,1-3H3/t28?,29-,30+,31+/m0/s1 |
| InChIKey | VZMYPVHTJIDALA-LLLBZREHSA-N |
| XLogP | 5.30 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|