C33H43NO4Si — CID 173332669
(3R,4S,5S)-1-[[dimethyl(prop-2-enyl)silyl]methyl]-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-3-ol (PubChem CID 173332669) has the molecular formula C33H43NO4Si and a molecular weight of 545.80 g/mol. Its IUPAC name is (3R,4S,5S)-1-[[dimethyl(prop-2-enyl)silyl]methyl]-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-3-ol.
| Compound Name | (3R,4S,5S)-1-[[dimethyl(prop-2-enyl)silyl]methyl]-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 173332669 |
| Molecular Formula | C33H43NO4Si |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | (3R,4S,5S)-1-[[dimethyl(prop-2-enyl)silyl]methyl]-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-3-ol |
| SMILES | C=CC[Si](C)(C)CN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)C1COCc1ccccc1 |
| InChI | InChI=1S/C33H43NO4Si/c1-4-20-39(2,3)26-34-21-31(37-23-28-16-10-6-11-17-28)33(38-24-29-18-12-7-13-19-29)32(35)30(34)25-36-22-27-14-8-5-9-15-27/h4-19,30-33,35H,1,20-26H2,2-3H3/t30?,31-,32+,33+/m0/s1 |
| InChIKey | MJEQESUVXWWHMW-WELGVCPWSA-N |
| XLogP | 5.85 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|