C30H35NO4 — CID 11754618
[(2R,3R,4S,5S)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]methanol (PubChem CID 11754618) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5S)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 11754618 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]methanol |
| SMILES | C=CCN1C[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C30H35NO4/c1-2-18-31-19-28(33-21-24-12-6-3-7-13-24)30(35-23-26-16-10-5-11-17-26)29(27(31)20-32)34-22-25-14-8-4-9-15-25/h2-17,27-30,32H,1,18-23H2/t27-,28+,29-,30+/m1/s1 |
| InChIKey | QLIIZMMYGWZFLR-ATIZSFMBSA-N |
| XLogP | 4.61 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|