C29H31NO2 — CID 45380156
(2R,3R,4R)-2-[(Z)-2-phenylethenyl]-3,4-bis(phenylmethoxy)-1-prop-2-enylpyrrolidine (PubChem CID 45380156) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(Z)-2-phenylethenyl]-3,4-bis(phenylmethoxy)-1-prop-2-enylpyrrolidine.
| Compound Name | (2R,3R,4R)-2-[(Z)-2-phenylethenyl]-3,4-bis(phenylmethoxy)-1-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 45380156 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (2R,3R,4R)-2-[(Z)-2-phenylethenyl]-3,4-bis(phenylmethoxy)-1-prop-2-enylpyrrolidine |
| SMILES | C=CCN1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1/C=C\c1ccccc1 |
| InChI | InChI=1S/C29H31NO2/c1-2-20-30-21-28(31-22-25-14-8-4-9-15-25)29(32-23-26-16-10-5-11-17-26)27(30)19-18-24-12-6-3-7-13-24/h2-19,27-29H,1,20-23H2/b19-18-/t27-,28-,29-/m1/s1 |
| InChIKey | GXQXDYKUIAAPTF-PLULOSSESA-N |
| XLogP | 5.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|