C27H29NO4 — CID 175873716
(3S,5R)-3,4,5-tris(phenylmethoxy)piperidine-1-carbaldehyde (PubChem CID 175873716) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (3S,5R)-3,4,5-tris(phenylmethoxy)piperidine-1-carbaldehyde.
| Compound Name | (3S,5R)-3,4,5-tris(phenylmethoxy)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 175873716 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (3S,5R)-3,4,5-tris(phenylmethoxy)piperidine-1-carbaldehyde |
| SMILES | O=CN1C[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C27H29NO4/c29-21-28-16-25(30-18-22-10-4-1-5-11-22)27(32-20-24-14-8-3-9-15-24)26(17-28)31-19-23-12-6-2-7-13-23/h1-15,21,25-27H,16-20H2/t25-,26+,27? |
| InChIKey | WGVWQQUWBJWBFC-ZVBBVAIHSA-N |
| XLogP | 4.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|