C24H27NO3 — CID 11731595
1-[(2R,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidin-1-yl]but-3-en-1-one (PubChem CID 11731595) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 1-[(2R,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidin-1-yl]but-3-en-1-one.
| Compound Name | 1-[(2R,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidin-1-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 11731595 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(2R,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidin-1-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)N1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1C=C |
| InChI | InChI=1S/C24H27NO3/c1-3-11-23(26)25-16-22(27-17-19-12-7-5-8-13-19)24(21(25)4-2)28-18-20-14-9-6-10-15-20/h3-10,12-15,21-22,24H,1-2,11,16-18H2/t21-,22+,24+/m1/s1 |
| InChIKey | BETLQUYXOLTGNA-GPXNEJASSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|