C28H37NO5 — CID 101127168
tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate (PubChem CID 101127168) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101127168 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO5/c1-6-24-26(33-19-22-15-11-8-12-16-22)25(32-18-21-13-9-7-10-14-21)23(20-31-5)17-29(24)27(30)34-28(2,3)4/h6-16,23-26H,1,17-20H2,2-5H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | PLBFZTXBIVDIKC-VEYUFSJPSA-N |
| XLogP | 5.23 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|