C20H28N2O5 — CID 58530036
1-O-tert-butyl 2-O-prop-2-enyl (2S,4R)-4-(phenylmethoxyamino)pyrrolidine-1,2-dicarboxylate (PubChem CID 58530036) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-prop-2-enyl (2S,4R)-4-(phenylmethoxyamino)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-prop-2-enyl (2S,4R)-4-(phenylmethoxyamino)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58530036 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-prop-2-enyl (2S,4R)-4-(phenylmethoxyamino)pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C[C@@H](NOCc2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28N2O5/c1-5-11-25-18(23)17-12-16(13-22(17)19(24)27-20(2,3)4)21-26-14-15-9-7-6-8-10-15/h5-10,16-17,21H,1,11-14H2,2-4H3/t16-,17+/m1/s1 |
| InChIKey | OJGXVZXSDFOHEQ-SJORKVTESA-N |
| XLogP | 2.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|