C23H27NO5 — CID 91327713
2-O-benzyl 1-O-tert-butyl (2S)-4-phenoxypyrrolidine-1,2-dicarboxylate (PubChem CID 91327713) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S)-4-phenoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S)-4-phenoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91327713 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S)-4-phenoxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccccc2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-23(2,3)29-22(26)24-15-19(28-18-12-8-5-9-13-18)14-20(24)21(25)27-16-17-10-6-4-7-11-17/h4-13,19-20H,14-16H2,1-3H3/t19?,20-/m0/s1 |
| InChIKey | CJKOGKCJVJIAQE-ANYOKISRSA-N |
| XLogP | 4.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |