C28H37NO6 — CID 11352172
tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethoxy)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate (PubChem CID 11352172) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethoxy)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethoxy)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11352172 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | tert-butyl (2R,3R,4R,5R)-2-ethenyl-5-(methoxymethoxy)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCOC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO6/c1-6-23-25(32-18-21-13-9-7-10-14-21)26(33-19-22-15-11-8-12-16-22)24(34-20-31-5)17-29(23)27(30)35-28(2,3)4/h6-16,23-26H,1,17-20H2,2-5H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | ISLSOPAMSDRYOL-VEYUFSJPSA-N |
| XLogP | 4.95 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|