C25H32N2O5S — CID 118366748
tert-butyl 4-(benzenesulfonyl)-2-ethenyl-5-(phenylmethoxymethyl)piperazine-1-carboxylate (PubChem CID 118366748) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is tert-butyl 4-(benzenesulfonyl)-2-ethenyl-5-(phenylmethoxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(benzenesulfonyl)-2-ethenyl-5-(phenylmethoxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118366748 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | tert-butyl 4-(benzenesulfonyl)-2-ethenyl-5-(phenylmethoxymethyl)piperazine-1-carboxylate |
| SMILES | C=CC1CN(S(=O)(=O)c2ccccc2)C(COCc2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N2O5S/c1-5-21-17-27(33(29,30)23-14-10-7-11-15-23)22(16-26(21)24(28)32-25(2,3)4)19-31-18-20-12-8-6-9-13-20/h5-15,21-22H,1,16-19H2,2-4H3 |
| InChIKey | QENHULRCDUSUQN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|