C30H39N3O6S — CID 146950696
tert-butyl (3S)-4-(benzenesulfonyl)-3-[(Z)-2-[(3S)-3-(phenylmethoxycarbonylamino)cyclopentyl]ethenyl]piperazine-1-carboxylate (PubChem CID 146950696) has the molecular formula C30H39N3O6S and a molecular weight of 569.72 g/mol. Its IUPAC name is tert-butyl (3S)-4-(benzenesulfonyl)-3-[(Z)-2-[(3S)-3-(phenylmethoxycarbonylamino)cyclopentyl]ethenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(benzenesulfonyl)-3-[(Z)-2-[(3S)-3-(phenylmethoxycarbonylamino)cyclopentyl]ethenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146950696 |
| Molecular Formula | C30H39N3O6S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | tert-butyl (3S)-4-(benzenesulfonyl)-3-[(Z)-2-[(3S)-3-(phenylmethoxycarbonylamino)cyclopentyl]ethenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccccc2)[C@@H](/C=C\C2CC[C@H](NC(=O)OCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C30H39N3O6S/c1-30(2,3)39-29(35)32-18-19-33(40(36,37)27-12-8-5-9-13-27)26(21-32)17-15-23-14-16-25(20-23)31-28(34)38-22-24-10-6-4-7-11-24/h4-13,15,17,23,25-26H,14,16,18-22H2,1-3H3,(H,31,34)/b17-15-/t23?,25-,26-/m0/s1 |
| InChIKey | AIRCOJJMVFGWRK-CZIZWWSNSA-N |
| XLogP | 4.95 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|