C19H27NO3 — CID 140904847
tert-butyl (2R,3R)-3-(phenylmethoxymethyl)-1-prop-2-enylazetidine-2-carboxylate (PubChem CID 140904847) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(phenylmethoxymethyl)-1-prop-2-enylazetidine-2-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-(phenylmethoxymethyl)-1-prop-2-enylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 140904847 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl (2R,3R)-3-(phenylmethoxymethyl)-1-prop-2-enylazetidine-2-carboxylate |
| SMILES | C=CCN1C[C@@H](COCc2ccccc2)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO3/c1-5-11-20-12-16(17(20)18(21)23-19(2,3)4)14-22-13-15-9-7-6-8-10-15/h5-10,16-17H,1,11-14H2,2-4H3/t16-,17+/m0/s1 |
| InChIKey | XYHLHRMJWCPTRV-DLBZAZTESA-N |
| XLogP | 3.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|