C23H34N2O5S — CID 118366715
tert-butyl 4-ethenylsulfonyl-3-(phenylmethoxymethyl)-6-prop-2-enyl-1,4-diazepane-1-carboxylate (PubChem CID 118366715) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is tert-butyl 4-ethenylsulfonyl-3-(phenylmethoxymethyl)-6-prop-2-enyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-ethenylsulfonyl-3-(phenylmethoxymethyl)-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 118366715 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | tert-butyl 4-ethenylsulfonyl-3-(phenylmethoxymethyl)-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
| SMILES | C=CCC1CN(C(=O)OC(C)(C)C)CC(COCc2ccccc2)N(S(=O)(=O)C=C)C1 |
| InChI | InChI=1S/C23H34N2O5S/c1-6-11-20-14-24(22(26)30-23(3,4)5)16-21(25(15-20)31(27,28)7-2)18-29-17-19-12-9-8-10-13-19/h6-10,12-13,20-21H,1-2,11,14-18H2,3-5H3 |
| InChIKey | UWQWKTCJEYWONQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|