C34H42NO8P — CID 11411021
(2S,3R,4S,5R)-1-(2-diethoxyphosphorylacetyl)-2-methyl-3,4,5-tris(phenylmethoxy)piperidine-2-carbaldehyde (PubChem CID 11411021) has the molecular formula C34H42NO8P and a molecular weight of 623.68 g/mol. Its IUPAC name is (2S,3R,4S,5R)-1-(2-diethoxyphosphorylacetyl)-2-methyl-3,4,5-tris(phenylmethoxy)piperidine-2-carbaldehyde.
| Compound Name | (2S,3R,4S,5R)-1-(2-diethoxyphosphorylacetyl)-2-methyl-3,4,5-tris(phenylmethoxy)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 11411021 |
| Molecular Formula | C34H42NO8P |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | (2S,3R,4S,5R)-1-(2-diethoxyphosphorylacetyl)-2-methyl-3,4,5-tris(phenylmethoxy)piperidine-2-carbaldehyde |
| SMILES | CCOP(=O)(CC(=O)N1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@]1(C)C=O)OCC |
| InChI | InChI=1S/C34H42NO8P/c1-4-42-44(38,43-5-2)25-31(37)35-21-30(39-22-27-15-9-6-10-16-27)32(40-23-28-17-11-7-12-18-28)33(34(35,3)26-36)41-24-29-19-13-8-14-20-29/h6-20,26,30,32-33H,4-5,21-25H2,1-3H3/t30-,32+,33+,34-/m1/s1 |
| InChIKey | SWBRTYADXZSTTP-SBLQOOQRSA-N |
| XLogP | 5.81 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|