C39H43NO5 — CID 177444812
1-[(3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-1-azabicyclo[4.1.0]heptan-7-yl]butan-1-one (PubChem CID 177444812) has the molecular formula C39H43NO5 and a molecular weight of 605.78 g/mol. Its IUPAC name is 1-[(3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-1-azabicyclo[4.1.0]heptan-7-yl]butan-1-one.
| Compound Name | 1-[(3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-1-azabicyclo[4.1.0]heptan-7-yl]butan-1-one |
|---|---|
| PubChem CID | 177444812 |
| Molecular Formula | C39H43NO5 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 1-[(3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-1-azabicyclo[4.1.0]heptan-7-yl]butan-1-one |
| SMILES | CCCC(=O)C1N2CC(OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@]12COCc1ccccc1 |
| InChI | InChI=1S/C39H43NO5/c1-2-15-34(41)37-39(29-42-25-30-16-7-3-8-17-30)38(45-28-33-22-13-6-14-23-33)36(44-27-32-20-11-5-12-21-32)35(24-40(37)39)43-26-31-18-9-4-10-19-31/h3-14,16-23,35-38H,2,15,24-29H2,1H3/t35?,36-,37?,38+,39+,40?/m1/s1 |
| InChIKey | GCNXNKXAVRIGHO-MHZFCGOLSA-N |
| XLogP | 6.77 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|