C37H48N2O4 — CID 155286505
2-methyl-1-[4-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]piperidin-1-yl]propan-1-one (PubChem CID 155286505) has the molecular formula C37H48N2O4 and a molecular weight of 584.80 g/mol. Its IUPAC name is 2-methyl-1-[4-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 155286505 |
| Molecular Formula | C37H48N2O4 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 2-methyl-1-[4-[[(2R,3R,4R,5S)-2-methyl-3,4,5-tris(phenylmethoxy)piperidin-1-yl]methyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCC(CN2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2C)CC1 |
| InChI | InChI=1S/C37H48N2O4/c1-28(2)37(40)38-21-19-30(20-22-38)23-39-24-34(41-25-31-13-7-4-8-14-31)36(43-27-33-17-11-6-12-18-33)35(29(39)3)42-26-32-15-9-5-10-16-32/h4-18,28-30,34-36H,19-27H2,1-3H3/t29-,34+,35-,36-/m1/s1 |
| InChIKey | ZUXDKSYARUTQJV-WQZSUXSPSA-N |
| XLogP | 6.34 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |