C35H37F2NO3 — CID 155286705
(2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 155286705) has the molecular formula C35H37F2NO3 and a molecular weight of 557.68 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 155286705 |
| Molecular Formula | C35H37F2NO3 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CCc1cccc(F)c1F |
| InChI | InChI=1S/C35H37F2NO3/c1-26-34(40-24-28-14-7-3-8-15-28)35(41-25-29-16-9-4-10-17-29)32(39-23-27-12-5-2-6-13-27)22-38(26)21-20-30-18-11-19-31(36)33(30)37/h2-19,26,32,34-35H,20-25H2,1H3/t26-,32+,34-,35-/m1/s1 |
| InChIKey | KAOSAKYTZXEWTF-IQZHTZKYSA-N |
| XLogP | 6.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |