C39H43F2NO4 — CID 155721186
(2R,3R,4R,5S)-1-[2-[4-(cyclopropylmethoxy)-2,6-difluorophenyl]ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 155721186) has the molecular formula C39H43F2NO4 and a molecular weight of 627.77 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-[4-(cyclopropylmethoxy)-2,6-difluorophenyl]ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[2-[4-(cyclopropylmethoxy)-2,6-difluorophenyl]ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 155721186 |
| Molecular Formula | C39H43F2NO4 |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-[4-(cyclopropylmethoxy)-2,6-difluorophenyl]ethyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CCc1c(F)cc(OCC2CC2)cc1F |
| InChI | InChI=1S/C39H43F2NO4/c1-28-38(45-26-30-13-7-3-8-14-30)39(46-27-31-15-9-4-10-16-31)37(44-25-29-11-5-2-6-12-29)23-42(28)20-19-34-35(40)21-33(22-36(34)41)43-24-32-17-18-32/h2-16,21-22,28,32,37-39H,17-20,23-27H2,1H3/t28-,37+,38-,39-/m1/s1 |
| InChIKey | BXGMJLOKXCXHCS-JIPMINFSSA-N |
| XLogP | 7.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |