C42H49F2NO4 — CID 175844519
(2S,3R,4R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 175844519) has the molecular formula C42H49F2NO4 and a molecular weight of 669.85 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2S,3R,4R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 175844519 |
| Molecular Formula | C42H49F2NO4 |
| Molecular Weight | 669.85 g/mol |
| Exact Mass | 669.36 |
| IUPAC Name | (2S,3R,4R,5S)-1-[[4-(difluoromethyl)cyclohexyl]methyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | FC(F)C1CCC(CN2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2COCc2ccccc2)CC1 |
| InChI | InChI=1S/C42H49F2NO4/c43-42(44)37-23-21-32(22-24-37)25-45-26-39(47-28-34-15-7-2-8-16-34)41(49-30-36-19-11-4-12-20-36)40(48-29-35-17-9-3-10-18-35)38(45)31-46-27-33-13-5-1-6-14-33/h1-20,32,37-42H,21-31H2/t32?,37?,38-,39-,40+,41+/m0/s1 |
| InChIKey | BALDETMCACDSRH-KTUBAYEFSA-N |
| XLogP | 8.72 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.85 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |