C37H48FNO3 — CID 155286620
(2S,3R,4R,5S)-2-(fluoromethyl)-3,4,5-tris(phenylmethoxy)-1-[(4-propan-2-ylcyclohexyl)methyl]piperidine (PubChem CID 155286620) has the molecular formula C37H48FNO3 and a molecular weight of 573.79 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(fluoromethyl)-3,4,5-tris(phenylmethoxy)-1-[(4-propan-2-ylcyclohexyl)methyl]piperidine.
| Compound Name | (2S,3R,4R,5S)-2-(fluoromethyl)-3,4,5-tris(phenylmethoxy)-1-[(4-propan-2-ylcyclohexyl)methyl]piperidine |
|---|---|
| PubChem CID | 155286620 |
| Molecular Formula | C37H48FNO3 |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | (2S,3R,4R,5S)-2-(fluoromethyl)-3,4,5-tris(phenylmethoxy)-1-[(4-propan-2-ylcyclohexyl)methyl]piperidine |
| SMILES | CC(C)C1CCC(CN2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2CF)CC1 |
| InChI | InChI=1S/C37H48FNO3/c1-28(2)33-20-18-29(19-21-33)23-39-24-35(40-25-30-12-6-3-7-13-30)37(42-27-32-16-10-5-11-17-32)36(34(39)22-38)41-26-31-14-8-4-9-15-31/h3-17,28-29,33-37H,18-27H2,1-2H3/t29?,33?,34-,35+,36-,37-/m1/s1 |
| InChIKey | OERWGBSMBBOJKE-NOSRZKGISA-N |
| XLogP | 7.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |